C13H9Cl2NO3 — CID 3387380
[1-(furan-2-yl)ethylideneamino] 2,4-dichlorobenzoate (PubChem CID 3387380) has the molecular formula C13H9Cl2NO3 and a molecular weight of 298.13 g/mol. Its IUPAC name is [1-(furan-2-yl)ethylideneamino] 2,4-dichlorobenzoate.
| Compound Name | [1-(furan-2-yl)ethylideneamino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3387380 |
| Molecular Formula | C13H9Cl2NO3 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | [1-(furan-2-yl)ethylideneamino] 2,4-dichlorobenzoate |
| SMILES | CC(=NOC(=O)c1ccc(Cl)cc1Cl)c1ccco1 |
| InChI | InChI=1S/C13H9Cl2NO3/c1-8(12-3-2-6-18-12)16-19-13(17)10-5-4-9(14)7-11(10)15/h2-7H,1H3 |
| InChIKey | JGKLZOWFTWANMD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|