C17H21N5O4S — CID 8971436
(2S)-2-[[4-[(Z)-N-[(4,6-dimethylpyrimidin-2-yl)amino]-C-methylcarbonimidoyl]phenyl]sulfonylamino]propanoic acid (PubChem CID 8971436) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is (2S)-2-[[4-[(Z)-N-[(4,6-dimethylpyrimidin-2-yl)amino]-C-methylcarbonimidoyl]phenyl]sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[[4-[(Z)-N-[(4,6-dimethylpyrimidin-2-yl)amino]-C-methylcarbonimidoyl]phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 8971436 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (2S)-2-[[4-[(Z)-N-[(4,6-dimethylpyrimidin-2-yl)amino]-C-methylcarbonimidoyl]phenyl]sulfonylamino]propanoic acid |
| SMILES | C/C(=N/Nc1nc(C)cc(C)n1)c1ccc(S(=O)(=O)N[C@@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C17H21N5O4S/c1-10-9-11(2)19-17(18-10)21-20-12(3)14-5-7-15(8-6-14)27(25,26)22-13(4)16(23)24/h5-9,13,22H,1-4H3,(H,23,24)(H,18,19,21)/b20-12-/t13-/m0/s1 |
| InChIKey | BDQCVEKYEDUTAU-RQZLXBNYSA-N |
| XLogP | 1.68 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|