C16H20N2O2S — CID 101377427
N-[(1R)-1-phenylpentyl]pyridine-2-sulfonamide (PubChem CID 101377427) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is N-[(1R)-1-phenylpentyl]pyridine-2-sulfonamide.
| Compound Name | N-[(1R)-1-phenylpentyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 101377427 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[(1R)-1-phenylpentyl]pyridine-2-sulfonamide |
| SMILES | CCCC[C@@H](NS(=O)(=O)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O2S/c1-2-3-11-15(14-9-5-4-6-10-14)18-21(19,20)16-12-7-8-13-17-16/h4-10,12-13,15,18H,2-3,11H2,1H3/t15-/m1/s1 |
| InChIKey | LMJRBSDVLHDVGA-OAHLLOKOSA-N |
| XLogP | 3.29 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |