C18H21ClN2O3S — CID 101456456
N-[1-(4-acetylphenyl)-5-chloropentyl]pyridine-2-sulfonamide (PubChem CID 101456456) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is N-[1-(4-acetylphenyl)-5-chloropentyl]pyridine-2-sulfonamide.
| Compound Name | N-[1-(4-acetylphenyl)-5-chloropentyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 101456456 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[1-(4-acetylphenyl)-5-chloropentyl]pyridine-2-sulfonamide |
| SMILES | CC(=O)c1ccc(C(CCCCCl)NS(=O)(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C18H21ClN2O3S/c1-14(22)15-8-10-16(11-9-15)17(6-2-4-12-19)21-25(23,24)18-7-3-5-13-20-18/h3,5,7-11,13,17,21H,2,4,6,12H2,1H3 |
| InChIKey | LPLOGCBLUUJUEZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|