C9H14N2O4S — CID 86048885
N-(2,2-dimethoxyethyl)pyridine-2-sulfonamide (PubChem CID 86048885) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)pyridine-2-sulfonamide.
| Compound Name | N-(2,2-dimethoxyethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 86048885 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(2,2-dimethoxyethyl)pyridine-2-sulfonamide |
| SMILES | COC(CNS(=O)(=O)c1ccccn1)OC |
| InChI | InChI=1S/C9H14N2O4S/c1-14-9(15-2)7-11-16(12,13)8-5-3-4-6-10-8/h3-6,9,11H,7H2,1-2H3 |
| InChIKey | KIACICDRSYVAMB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|