C13H21N3O5S — CID 58981687
tert-butyl N-[2-hydroxy-3-(pyridin-2-ylsulfonylamino)propyl]carbamate (PubChem CID 58981687) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is tert-butyl N-[2-hydroxy-3-(pyridin-2-ylsulfonylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-hydroxy-3-(pyridin-2-ylsulfonylamino)propyl]carbamate |
|---|---|
| PubChem CID | 58981687 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | tert-butyl N-[2-hydroxy-3-(pyridin-2-ylsulfonylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)CNS(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C13H21N3O5S/c1-13(2,3)21-12(18)15-8-10(17)9-16-22(19,20)11-6-4-5-7-14-11/h4-7,10,16-17H,8-9H2,1-3H3,(H,15,18) |
| InChIKey | GWNZQGCHLOLOMZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |