C9H12N2O4S — CID 122067598
4-(pyridin-2-ylsulfonylamino)butanoic acid (PubChem CID 122067598) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is 4-(pyridin-2-ylsulfonylamino)butanoic acid.
| Compound Name | 4-(pyridin-2-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 122067598 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 4-(pyridin-2-ylsulfonylamino)butanoic acid |
| SMILES | O=C(O)CCCNS(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C9H12N2O4S/c12-9(13)5-3-7-11-16(14,15)8-4-1-2-6-10-8/h1-2,4,6,11H,3,5,7H2,(H,12,13) |
| InChIKey | JTQMXXQKXILEFL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|