C22H26Cl3NO4S — CID 147662671
2,2,2-trichloroethyl N-[1-[4-(4-acetylphenyl)phenyl]hexyl]sulfamate (PubChem CID 147662671) has the molecular formula C22H26Cl3NO4S and a molecular weight of 506.88 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[1-[4-(4-acetylphenyl)phenyl]hexyl]sulfamate.
| Compound Name | 2,2,2-trichloroethyl N-[1-[4-(4-acetylphenyl)phenyl]hexyl]sulfamate |
|---|---|
| PubChem CID | 147662671 |
| Molecular Formula | C22H26Cl3NO4S |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 2,2,2-trichloroethyl N-[1-[4-(4-acetylphenyl)phenyl]hexyl]sulfamate |
| SMILES | CCCCCC(NS(=O)(=O)OCC(Cl)(Cl)Cl)c1ccc(-c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C22H26Cl3NO4S/c1-3-4-5-6-21(26-31(28,29)30-15-22(23,24)25)20-13-11-19(12-14-20)18-9-7-17(8-10-18)16(2)27/h7-14,21,26H,3-6,15H2,1-2H3 |
| InChIKey | GLRCIOKUHDZZRI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|