C17H25NO3S — CID 146165550
tert-butyl N-[(1S)-1-(4-acetylphenyl)-3-methylsulfanylpropyl]carbamate (PubChem CID 146165550) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-acetylphenyl)-3-methylsulfanylpropyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(4-acetylphenyl)-3-methylsulfanylpropyl]carbamate |
|---|---|
| PubChem CID | 146165550 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-acetylphenyl)-3-methylsulfanylpropyl]carbamate |
| SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-12(19)13-6-8-14(9-7-13)15(10-11-22-5)18-16(20)21-17(2,3)4/h6-9,15H,10-11H2,1-5H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | CHQFTAJQTIAGJY-HNNXBMFYSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |