C20H32N4O3S — CID 133454493
4-[[6-[3-(azepan-1-yl)piperidin-1-yl]-3-pyridinyl]sulfonyl]morpholine (PubChem CID 133454493) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is 4-[[6-[3-(azepan-1-yl)piperidin-1-yl]-3-pyridinyl]sulfonyl]morpholine.
| Compound Name | 4-[[6-[3-(azepan-1-yl)piperidin-1-yl]-3-pyridinyl]sulfonyl]morpholine |
|---|---|
| PubChem CID | 133454493 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-[[6-[3-(azepan-1-yl)piperidin-1-yl]-3-pyridinyl]sulfonyl]morpholine |
| SMILES | O=S(=O)(c1ccc(N2CCCC(N3CCCCCC3)C2)nc1)N1CCOCC1 |
| InChI | InChI=1S/C20H32N4O3S/c25-28(26,24-12-14-27-15-13-24)19-7-8-20(21-16-19)23-11-5-6-18(17-23)22-9-3-1-2-4-10-22/h7-8,16,18H,1-6,9-15,17H2 |
| InChIKey | SHZRRVLKSOJPDS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |