C16H21F3N4O — CID 94810988
(2R)-N-cyclopropyl-2-[4-[6-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide (PubChem CID 94810988) has the molecular formula C16H21F3N4O and a molecular weight of 342.37 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-[4-[6-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-cyclopropyl-2-[4-[6-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 94810988 |
| Molecular Formula | C16H21F3N4O |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2R)-N-cyclopropyl-2-[4-[6-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NC1CC1)N1CCN(c2cccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C16H21F3N4O/c1-11(15(24)20-12-5-6-12)22-7-9-23(10-8-22)14-4-2-3-13(21-14)16(17,18)19/h2-4,11-12H,5-10H2,1H3,(H,20,24)/t11-/m1/s1 |
| InChIKey | BRFWNXLXLCPOOD-LLVKDONJSA-N |
| XLogP | 1.89 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |