C24H30N4O4S — CID 43038050
(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(6-morpholin-4-yl-3-pyridinyl)prop-2-enamide (PubChem CID 43038050) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(6-morpholin-4-yl-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(6-morpholin-4-yl-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 43038050 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(6-morpholin-4-yl-3-pyridinyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)N2CCCCCC2)cc1)Nc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C24H30N4O4S/c29-24(26-21-8-11-23(25-19-21)27-15-17-32-18-16-27)12-7-20-5-9-22(10-6-20)33(30,31)28-13-3-1-2-4-14-28/h5-12,19H,1-4,13-18H2,(H,26,29)/b12-7+ |
| InChIKey | PSMUJUYPLOJEBC-KPKJPENVSA-N |
| XLogP | 3.13 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|