C16H13N3O6S — CID 89238764
N-[5-[5-(1,2-oxazol-5-yl)furan-2-yl]sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide (PubChem CID 89238764) has the molecular formula C16H13N3O6S and a molecular weight of 375.36 g/mol. Its IUPAC name is N-[5-[5-(1,2-oxazol-5-yl)furan-2-yl]sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide.
| Compound Name | N-[5-[5-(1,2-oxazol-5-yl)furan-2-yl]sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238764 |
| Molecular Formula | C16H13N3O6S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[5-[5-(1,2-oxazol-5-yl)furan-2-yl]sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(o1)CN(S(=O)(=O)c1ccc(-c3ccno3)o1)C2 |
| InChI | InChI=1S/C16H13N3O6S/c1-2-14(20)18-15-7-10-8-19(9-13(10)23-15)26(21,22)16-4-3-11(24-16)12-5-6-17-25-12/h2-7H,1,8-9H2,(H,18,20) |
| InChIKey | RJLZBPKKRJFIDF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|