C20H22N2O5S — CID 89237448
N-[5-(4-cyclopentyloxyphenyl)sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide (PubChem CID 89237448) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[5-(4-cyclopentyloxyphenyl)sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide.
| Compound Name | N-[5-(4-cyclopentyloxyphenyl)sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89237448 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[5-(4-cyclopentyloxyphenyl)sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(o1)CN(S(=O)(=O)c1ccc(OC3CCCC3)cc1)C2 |
| InChI | InChI=1S/C20H22N2O5S/c1-2-19(23)21-20-11-14-12-22(13-18(14)27-20)28(24,25)17-9-7-16(8-10-17)26-15-5-3-4-6-15/h2,7-11,15H,1,3-6,12-13H2,(H,21,23) |
| InChIKey | FABYOIYKDPTZAU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|