C21H23N3O5S — CID 89237208
N-[5-[3-(piperidine-1-carbonyl)phenyl]sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide (PubChem CID 89237208) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[5-[3-(piperidine-1-carbonyl)phenyl]sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide.
| Compound Name | N-[5-[3-(piperidine-1-carbonyl)phenyl]sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89237208 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[5-[3-(piperidine-1-carbonyl)phenyl]sulfonyl-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(o1)CN(S(=O)(=O)c1cccc(C(=O)N3CCCCC3)c1)C2 |
| InChI | InChI=1S/C21H23N3O5S/c1-2-19(25)22-20-12-16-13-24(14-18(16)29-20)30(27,28)17-8-6-7-15(11-17)21(26)23-9-4-3-5-10-23/h2,6-8,11-12H,1,3-5,9-10,13-14H2,(H,22,25) |
| InChIKey | ZRLGPMMFYWSJBM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|