C23H25N3O4S — CID 89237338
N-[3-[[4-[(2-phenylacetyl)amino]phenyl]methylsulfonyl]-3-azabicyclo[3.1.0]hexan-6-yl]prop-2-enamide (PubChem CID 89237338) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[3-[[4-[(2-phenylacetyl)amino]phenyl]methylsulfonyl]-3-azabicyclo[3.1.0]hexan-6-yl]prop-2-enamide.
| Compound Name | N-[3-[[4-[(2-phenylacetyl)amino]phenyl]methylsulfonyl]-3-azabicyclo[3.1.0]hexan-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89237338 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[3-[[4-[(2-phenylacetyl)amino]phenyl]methylsulfonyl]-3-azabicyclo[3.1.0]hexan-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1C2CN(S(=O)(=O)Cc3ccc(NC(=O)Cc4ccccc4)cc3)CC21 |
| InChI | InChI=1S/C23H25N3O4S/c1-2-21(27)25-23-19-13-26(14-20(19)23)31(29,30)15-17-8-10-18(11-9-17)24-22(28)12-16-6-4-3-5-7-16/h2-11,19-20,23H,1,12-15H2,(H,24,28)(H,25,27) |
| InChIKey | YKXHNNZKUUSQGB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|