C25H29N3O5S — CID 89236037
N-[6-[[4-[(2-phenylacetyl)amino]phenyl]methylsulfonyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]prop-2-enamide (PubChem CID 89236037) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-[6-[[4-[(2-phenylacetyl)amino]phenyl]methylsulfonyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]prop-2-enamide.
| Compound Name | N-[6-[[4-[(2-phenylacetyl)amino]phenyl]methylsulfonyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89236037 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[6-[[4-[(2-phenylacetyl)amino]phenyl]methylsulfonyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC2CCN(S(=O)(=O)Cc3ccc(NC(=O)Cc4ccccc4)cc3)CC2O1 |
| InChI | InChI=1S/C25H29N3O5S/c1-2-23(29)27-25-15-20-12-13-28(16-22(20)33-25)34(31,32)17-19-8-10-21(11-9-19)26-24(30)14-18-6-4-3-5-7-18/h2-11,20,22,25H,1,12-17H2,(H,26,30)(H,27,29) |
| InChIKey | SVVOMCZIUWCJBI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|