C26H31N3O6S — CID 89237797
N-[2-(4-methoxyphenyl)ethyl]-4-[[2-(prop-2-enoylamino)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]sulfonyl]benzamide (PubChem CID 89237797) has the molecular formula C26H31N3O6S and a molecular weight of 513.62 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-4-[[2-(prop-2-enoylamino)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]sulfonyl]benzamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-4-[[2-(prop-2-enoylamino)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 89237797 |
| Molecular Formula | C26H31N3O6S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-4-[[2-(prop-2-enoylamino)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]sulfonyl]benzamide |
| SMILES | C=CC(=O)NC1CC2CCN(S(=O)(=O)c3ccc(C(=O)NCCc4ccc(OC)cc4)cc3)CC2O1 |
| InChI | InChI=1S/C26H31N3O6S/c1-3-24(30)28-25-16-20-13-15-29(17-23(20)35-25)36(32,33)22-10-6-19(7-11-22)26(31)27-14-12-18-4-8-21(34-2)9-5-18/h3-11,20,23,25H,1,12-17H2,2H3,(H,27,31)(H,28,30) |
| InChIKey | ZQRCVONIRQZFTA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|