C24H29N3O4S — CID 89236684
N-benzyl-4-[3,5-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide (PubChem CID 89236684) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is N-benzyl-4-[3,5-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-benzyl-4-[3,5-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89236684 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | N-benzyl-4-[3,5-dimethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1C(C)CN(S(=O)(=O)c2ccc(C(=O)NCc3ccccc3)cc2)CC1C |
| InChI | InChI=1S/C24H29N3O4S/c1-4-22(28)26-23-17(2)15-27(16-18(23)3)32(30,31)21-12-10-20(11-13-21)24(29)25-14-19-8-6-5-7-9-19/h4-13,17-18,23H,1,14-16H2,2-3H3,(H,25,29)(H,26,28) |
| InChIKey | RJESATKQNMVMHT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|