C24H29N3O5S — CID 89237888
N-[(3,5-dimethylphenyl)methyl]-4-[2-(hydroxymethyl)-4-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide (PubChem CID 89237888) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-[(3,5-dimethylphenyl)methyl]-4-[2-(hydroxymethyl)-4-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[(3,5-dimethylphenyl)methyl]-4-[2-(hydroxymethyl)-4-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89237888 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[(3,5-dimethylphenyl)methyl]-4-[2-(hydroxymethyl)-4-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1CC(CO)N(S(=O)(=O)c2ccc(C(=O)NCc3cc(C)cc(C)c3)cc2)C1 |
| InChI | InChI=1S/C24H29N3O5S/c1-4-23(29)26-20-12-21(15-28)27(14-20)33(31,32)22-7-5-19(6-8-22)24(30)25-13-18-10-16(2)9-17(3)11-18/h4-11,20-21,28H,1,12-15H2,2-3H3,(H,25,30)(H,26,29) |
| InChIKey | UHSSKYFLNSRTGP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|