C23H25F2N3O4S — CID 89238513
N-[(3,4-difluorophenyl)methyl]-4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide (PubChem CID 89238513) has the molecular formula C23H25F2N3O4S and a molecular weight of 477.53 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89238513 |
| Molecular Formula | C23H25F2N3O4S |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc(C(=O)NCc3ccc(F)c(F)c3)cc2)C(C)C1 |
| InChI | InChI=1S/C23H25F2N3O4S/c1-3-22(29)27-18-10-11-28(15(2)12-18)33(31,32)19-7-5-17(6-8-19)23(30)26-14-16-4-9-20(24)21(25)13-16/h3-9,13,15,18H,1,10-12,14H2,2H3,(H,26,30)(H,27,29) |
| InChIKey | UDUWNUCQVWSNNY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|