C25H32N4O5S — CID 89237316
N-[4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-5-(pyrrolidin-1-ylmethyl)furan-2-carboxamide (PubChem CID 89237316) has the molecular formula C25H32N4O5S and a molecular weight of 500.62 g/mol. Its IUPAC name is N-[4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-5-(pyrrolidin-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-5-(pyrrolidin-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 89237316 |
| Molecular Formula | C25H32N4O5S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | N-[4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-5-(pyrrolidin-1-ylmethyl)furan-2-carboxamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc(NC(=O)c3ccc(CN4CCCC4)o3)cc2)C(C)C1 |
| InChI | InChI=1S/C25H32N4O5S/c1-3-24(30)26-20-12-15-29(18(2)16-20)35(32,33)22-9-6-19(7-10-22)27-25(31)23-11-8-21(34-23)17-28-13-4-5-14-28/h3,6-11,18,20H,1,4-5,12-17H2,2H3,(H,26,30)(H,27,31) |
| InChIKey | SKUVZFMVFQZGTP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|