C24H29N3O4S2 — CID 89238172
N-[4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 89238172) has the molecular formula C24H29N3O4S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-[4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 89238172 |
| Molecular Formula | C24H29N3O4S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-[4-[2-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc(NC(=O)c3cc4c(s3)CCCC4)cc2)C(C)C1 |
| InChI | InChI=1S/C24H29N3O4S2/c1-3-23(28)25-19-12-13-27(16(2)14-19)33(30,31)20-10-8-18(9-11-20)26-24(29)22-15-17-6-4-5-7-21(17)32-22/h3,8-11,15-16,19H,1,4-7,12-14H2,2H3,(H,25,28)(H,26,29) |
| InChIKey | YVFFXUQMPOJJBM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|