C24H27N3O4S2 — CID 89237969
N-[4-[[5-(prop-2-enoylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]phenyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide (PubChem CID 89237969) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[4-[[5-(prop-2-enoylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]phenyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide.
| Compound Name | N-[4-[[5-(prop-2-enoylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]phenyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 89237969 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[4-[[5-(prop-2-enoylamino)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]phenyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc(NC(=O)c4cc5c(s4)CCC5)cc3)CC2C1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-2-23(28)25-19-10-16-13-27(14-17(16)11-19)33(30,31)20-8-6-18(7-9-20)26-24(29)22-12-15-4-3-5-21(15)32-22/h2,6-9,12,16-17,19H,1,3-5,10-11,13-14H2,(H,25,28)(H,26,29) |
| InChIKey | VWUUKMUBLVKVHE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|