C21H29N3O5S — CID 89236492
N-cyclohexyl-4-[2-(hydroxymethyl)-4-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide (PubChem CID 89236492) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-cyclohexyl-4-[2-(hydroxymethyl)-4-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide.
| Compound Name | N-cyclohexyl-4-[2-(hydroxymethyl)-4-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89236492 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-cyclohexyl-4-[2-(hydroxymethyl)-4-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1CC(CO)N(S(=O)(=O)c2ccc(C(=O)NC3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C21H29N3O5S/c1-2-20(26)22-17-12-18(14-25)24(13-17)30(28,29)19-10-8-15(9-11-19)21(27)23-16-6-4-3-5-7-16/h2,8-11,16-18,25H,1,3-7,12-14H2,(H,22,26)(H,23,27) |
| InChIKey | BARZLLKCALRNQM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|