C25H29N3O5S2 — CID 89238128
N-[3-methoxy-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]-3-phenylpropanamide (PubChem CID 89238128) has the molecular formula C25H29N3O5S2 and a molecular weight of 515.66 g/mol. Its IUPAC name is N-[3-methoxy-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]-3-phenylpropanamide.
| Compound Name | N-[3-methoxy-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 89238128 |
| Molecular Formula | C25H29N3O5S2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | N-[3-methoxy-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]-3-phenylpropanamide |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc(NC(=O)CCc4ccccc4)cc3OC)CC2S1 |
| InChI | InChI=1S/C25H29N3O5S2/c1-3-23(29)27-25-13-18-15-28(16-21(18)34-25)35(31,32)22-11-10-19(14-20(22)33-2)26-24(30)12-9-17-7-5-4-6-8-17/h3-8,10-11,14,18,21,25H,1,9,12-13,15-16H2,2H3,(H,26,30)(H,27,29) |
| InChIKey | MPJOJOVMJVMTCE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|