C24H29N3O5S — CID 89237597
N-[3-methoxy-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-3-phenylpropanamide (PubChem CID 89237597) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-[3-methoxy-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-3-phenylpropanamide.
| Compound Name | N-[3-methoxy-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 89237597 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[3-methoxy-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylphenyl]-3-phenylpropanamide |
| SMILES | C=CC(=O)N[C@H]1CCCN(S(=O)(=O)c2ccc(NC(=O)CCc3ccccc3)cc2OC)C1 |
| InChI | InChI=1S/C24H29N3O5S/c1-3-23(28)26-20-10-7-15-27(17-20)33(30,31)22-13-12-19(16-21(22)32-2)25-24(29)14-11-18-8-5-4-6-9-18/h3-6,8-9,12-13,16,20H,1,7,10-11,14-15,17H2,2H3,(H,25,29)(H,26,28)/t20-/m0/s1 |
| InChIKey | HMPIZDSSRRYXPW-FQEVSTJZSA-N |
| XLogP | 2.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|