C22H32N4O4S — CID 89238552
N-(2-phenylethyl)-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylpiperidine-1-carboxamide (PubChem CID 89238552) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-(2-phenylethyl)-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylpiperidine-1-carboxamide.
| Compound Name | N-(2-phenylethyl)-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 89238552 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-(2-phenylethyl)-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylpiperidine-1-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCCN(S(=O)(=O)C2CCN(C(=O)NCCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C22H32N4O4S/c1-2-21(27)24-19-9-6-14-26(17-19)31(29,30)20-11-15-25(16-12-20)22(28)23-13-10-18-7-4-3-5-8-18/h2-5,7-8,19-20H,1,6,9-17H2,(H,23,28)(H,24,27)/t19-/m0/s1 |
| InChIKey | HBJRNWXEIARTTD-IBGZPJMESA-N |
| XLogP | 1.50 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|