C23H34N4O4S — CID 89237815
4-[4-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonyl-N-(2-phenylethyl)piperidine-1-carboxamide (PubChem CID 89237815) has the molecular formula C23H34N4O4S and a molecular weight of 462.62 g/mol. Its IUPAC name is 4-[4-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonyl-N-(2-phenylethyl)piperidine-1-carboxamide.
| Compound Name | 4-[4-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonyl-N-(2-phenylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 89237815 |
| Molecular Formula | C23H34N4O4S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 4-[4-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonyl-N-(2-phenylethyl)piperidine-1-carboxamide |
| SMILES | C=CC(=O)NC1(C)CCN(S(=O)(=O)C2CCN(C(=O)NCCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C23H34N4O4S/c1-3-21(28)25-23(2)12-17-27(18-13-23)32(30,31)20-10-15-26(16-11-20)22(29)24-14-9-19-7-5-4-6-8-19/h3-8,20H,1,9-18H2,2H3,(H,24,29)(H,25,28) |
| InChIKey | KQLZPTTXFKJSPS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|