C25H37N3O4S — CID 89238925
N-[2,2,5,5-tetramethyl-1-[1-(3-phenylpropanoyl)piperidin-4-yl]sulfonylpyrrolidin-3-yl]prop-2-enamide (PubChem CID 89238925) has the molecular formula C25H37N3O4S and a molecular weight of 475.66 g/mol. Its IUPAC name is N-[2,2,5,5-tetramethyl-1-[1-(3-phenylpropanoyl)piperidin-4-yl]sulfonylpyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[2,2,5,5-tetramethyl-1-[1-(3-phenylpropanoyl)piperidin-4-yl]sulfonylpyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238925 |
| Molecular Formula | C25H37N3O4S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N-[2,2,5,5-tetramethyl-1-[1-(3-phenylpropanoyl)piperidin-4-yl]sulfonylpyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC(C)(C)N(S(=O)(=O)C2CCN(C(=O)CCc3ccccc3)CC2)C1(C)C |
| InChI | InChI=1S/C25H37N3O4S/c1-6-22(29)26-21-18-24(2,3)28(25(21,4)5)33(31,32)20-14-16-27(17-15-20)23(30)13-12-19-10-8-7-9-11-19/h6-11,20-21H,1,12-18H2,2-5H3,(H,26,29) |
| InChIKey | XKZYJUNJPSOISF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|