C19H21N3O5S — CID 89236617
N-(2-phenylethyl)-5-[3-(prop-2-enoylamino)azetidin-1-yl]sulfonylfuran-2-carboxamide (PubChem CID 89236617) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-(2-phenylethyl)-5-[3-(prop-2-enoylamino)azetidin-1-yl]sulfonylfuran-2-carboxamide.
| Compound Name | N-(2-phenylethyl)-5-[3-(prop-2-enoylamino)azetidin-1-yl]sulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 89236617 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-(2-phenylethyl)-5-[3-(prop-2-enoylamino)azetidin-1-yl]sulfonylfuran-2-carboxamide |
| SMILES | C=CC(=O)NC1CN(S(=O)(=O)c2ccc(C(=O)NCCc3ccccc3)o2)C1 |
| InChI | InChI=1S/C19H21N3O5S/c1-2-17(23)21-15-12-22(13-15)28(25,26)18-9-8-16(27-18)19(24)20-11-10-14-6-4-3-5-7-14/h2-9,15H,1,10-13H2,(H,20,24)(H,21,23) |
| InChIKey | ZPFWXGBCKAGCLK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|