C27H33N3O4S — CID 89237048
N-(2,3-dihydro-1H-inden-2-yl)-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide (PubChem CID 89237048) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89237048 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1CC(C)(C)N(S(=O)(=O)c2ccc(C(=O)NC3Cc4ccccc4C3)cc2)C1(C)C |
| InChI | InChI=1S/C27H33N3O4S/c1-6-24(31)29-23-17-26(2,3)30(27(23,4)5)35(33,34)22-13-11-18(12-14-22)25(32)28-21-15-19-9-7-8-10-20(19)16-21/h6-14,21,23H,1,15-17H2,2-5H3,(H,28,32)(H,29,31) |
| InChIKey | BBGBAIYZGYFLJO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|