C22H32N4O5S — CID 89237031
4-[3-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonyl-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 89237031) has the molecular formula C22H32N4O5S and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-[3-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonyl-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 4-[3-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonyl-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 89237031 |
| Molecular Formula | C22H32N4O5S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 4-[3-methyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonyl-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc(C(=O)NCCN3CCOCC3)cc2)CC1C |
| InChI | InChI=1S/C22H32N4O5S/c1-3-21(27)24-20-8-10-26(16-17(20)2)32(29,30)19-6-4-18(5-7-19)22(28)23-9-11-25-12-14-31-15-13-25/h3-7,17,20H,1,8-16H2,2H3,(H,23,28)(H,24,27) |
| InChIKey | MHZOFIHRSLQCCR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|