C22H30FNO4S — CID 98331250
[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 98331250) has the molecular formula C22H30FNO4S and a molecular weight of 423.55 g/mol. Its IUPAC name is [(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 98331250 |
| Molecular Formula | C22H30FNO4S |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | C[C@H]1[C@@H](OC(=O)C2CCN(S(=O)(=O)c3ccccc3F)CC2)C[C@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C22H30FNO4S/c1-14-17-12-16(22(17,2)3)13-19(14)28-21(25)15-8-10-24(11-9-15)29(26,27)20-7-5-4-6-18(20)23/h4-7,14-17,19H,8-13H2,1-3H3/t14-,16-,17-,19+/m1/s1 |
| InChIKey | MBLHPHOEBDBRME-MYZZLAAOSA-N |
| XLogP | 3.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |