C17H22FNO4S — CID 55691626
methyl 1-(2-fluoro-5-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 55691626) has the molecular formula C17H22FNO4S and a molecular weight of 355.43 g/mol. Its IUPAC name is methyl 1-(2-fluoro-5-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-(2-fluoro-5-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 55691626 |
| Molecular Formula | C17H22FNO4S |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | methyl 1-(2-fluoro-5-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1S(=O)(=O)c1cc(C)ccc1F |
| InChI | InChI=1S/C17H22FNO4S/c1-11-7-8-13(18)16(9-11)24(21,22)19-14-6-4-3-5-12(14)10-15(19)17(20)23-2/h7-9,12,14-15H,3-6,10H2,1-2H3 |
| InChIKey | DZUODKSKPWCKJN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |