C24H36ClN3O3S — CID 52518504
(2S,3aR,7aS)-1-(2-chloro-4-methylphenyl)sulfonyl-N-(1-ethylpiperidin-4-yl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 52518504) has the molecular formula C24H36ClN3O3S and a molecular weight of 482.09 g/mol. Its IUPAC name is (2S,3aR,7aS)-1-(2-chloro-4-methylphenyl)sulfonyl-N-(1-ethylpiperidin-4-yl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aR,7aS)-1-(2-chloro-4-methylphenyl)sulfonyl-N-(1-ethylpiperidin-4-yl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 52518504 |
| Molecular Formula | C24H36ClN3O3S |
| Molecular Weight | 482.09 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (2S,3aR,7aS)-1-(2-chloro-4-methylphenyl)sulfonyl-N-(1-ethylpiperidin-4-yl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CCN1CCC(N(C)C(=O)[C@@H]2C[C@H]3CCCC[C@@H]3N2S(=O)(=O)c2ccc(C)cc2Cl)CC1 |
| InChI | InChI=1S/C24H36ClN3O3S/c1-4-27-13-11-19(12-14-27)26(3)24(29)22-16-18-7-5-6-8-21(18)28(22)32(30,31)23-10-9-17(2)15-20(23)25/h9-10,15,18-19,21-22H,4-8,11-14,16H2,1-3H3/t18-,21+,22+/m1/s1 |
| InChIKey | DDUZAMCARNMKPS-COPCDDAFSA-N |
| XLogP | 3.91 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.09 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |