C12H8F6O8S2 — CID 2306785
dimethyl 4,5-bis(trifluoromethylsulfonyl)benzene-1,2-dicarboxylate (PubChem CID 2306785) has the molecular formula C12H8F6O8S2 and a molecular weight of 458.31 g/mol. Its IUPAC name is dimethyl 4,5-bis(trifluoromethylsulfonyl)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4,5-bis(trifluoromethylsulfonyl)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 2306785 |
| Molecular Formula | C12H8F6O8S2 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | dimethyl 4,5-bis(trifluoromethylsulfonyl)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)C(F)(F)F)c(S(=O)(=O)C(F)(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C12H8F6O8S2/c1-25-9(19)5-3-7(27(21,22)11(13,14)15)8(4-6(5)10(20)26-2)28(23,24)12(16,17)18/h3-4H,1-2H3 |
| InChIKey | MLYCKXUTNRMUHQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |