C14H18O6S — CID 15782892
dimethyl 2-tert-butylsulfonylbenzene-1,3-dicarboxylate (PubChem CID 15782892) has the molecular formula C14H18O6S and a molecular weight of 314.36 g/mol. Its IUPAC name is dimethyl 2-tert-butylsulfonylbenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 2-tert-butylsulfonylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 15782892 |
| Molecular Formula | C14H18O6S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | dimethyl 2-tert-butylsulfonylbenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cccc(C(=O)OC)c1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C14H18O6S/c1-14(2,3)21(17,18)11-9(12(15)19-4)7-6-8-10(11)13(16)20-5/h6-8H,1-5H3 |
| InChIKey | PDLGJKIRDDZQDX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |