About ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid
ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid (PubChem CID 175529964) has the molecular formula C11H16O6S
and a molecular weight of 276.31 g/mol. Its IUPAC name is ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid.
Molecular Properties
| Compound Name | ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid |
| PubChem CID | 175529964 |
| Molecular Formula | C11H16O6S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid |
| SMILES | CC.COC(=O)c1cccc(S(=O)(=O)O)c1OC |
| InChI | InChI=1S/C9H10O6S.C2H6/c1-14-8-6(9(10)15-2)4-3-5-7(8)16(11,12)13;1-2/h3-5H,1-2H3,(H,11,12,13);1-2H3 |
| InChIKey | KZQHPJPHHZUZRS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid?
The IUPAC name of ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid (CID 175529964) is ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid.
What is the SMILES notation for ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid?
The canonical SMILES for ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid is CC.COC(=O)c1cccc(S(=O)(=O)O)c1OC.
What is the InChIKey of ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid?
The InChIKey is KZQHPJPHHZUZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O6S.C2H6/c1-14-8-6(9(10)15-2)4-3-5-7(8)16(11,12)13;1-2/h3-5H,1-2H3,(H,11,12,13);1-2H3.
What are the key properties of ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid?
ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid has a molecular weight of 276.31 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-3-methoxycarbonylbenzenesulfonic acid is sourced from PubChem (CID 175529964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).