C11H10F2O4 — CID 175282660
methyl 3-acetyl-2,5-difluoro-4-methoxybenzoate (PubChem CID 175282660) has the molecular formula C11H10F2O4 and a molecular weight of 244.19 g/mol. Its IUPAC name is methyl 3-acetyl-2,5-difluoro-4-methoxybenzoate.
| Compound Name | methyl 3-acetyl-2,5-difluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 175282660 |
| Molecular Formula | C11H10F2O4 |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | methyl 3-acetyl-2,5-difluoro-4-methoxybenzoate |
| SMILES | COC(=O)c1cc(F)c(OC)c(C(C)=O)c1F |
| InChI | InChI=1S/C11H10F2O4/c1-5(14)8-9(13)6(11(15)17-3)4-7(12)10(8)16-2/h4H,1-3H3 |
| InChIKey | JXSJYLHABMAYGI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |