C10H7F3O3 — CID 164845102
methyl (Z)-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate (PubChem CID 164845102) has the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. Its IUPAC name is methyl (Z)-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate.
| Compound Name | methyl (Z)-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 164845102 |
| Molecular Formula | C10H7F3O3 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | methyl (Z)-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate |
| SMILES | COC(=O)/C=C(\O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H7F3O3/c1-16-10(15)4-9(14)5-2-7(12)8(13)3-6(5)11/h2-4,14H,1H3/b9-4- |
| InChIKey | NBOSQISIRVOZEL-WTKPLQERSA-N |
| XLogP | 2.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|