C10H5F3O3 — CID 87857019
prop-2-enoyl 2,4,5-trifluorobenzoate (PubChem CID 87857019) has the molecular formula C10H5F3O3 and a molecular weight of 230.14 g/mol. Its IUPAC name is prop-2-enoyl 2,4,5-trifluorobenzoate.
| Compound Name | prop-2-enoyl 2,4,5-trifluorobenzoate |
|---|---|
| PubChem CID | 87857019 |
| Molecular Formula | C10H5F3O3 |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | prop-2-enoyl 2,4,5-trifluorobenzoate |
| SMILES | C=CC(=O)OC(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H5F3O3/c1-2-9(14)16-10(15)5-3-7(12)8(13)4-6(5)11/h2-4H,1H2 |
| InChIKey | KFIYRUZGOMIIMY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|