C10H9F3O — CID 22953700
2-methyl-1-(2,4,5-trifluorophenyl)propan-1-one (PubChem CID 22953700) has the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. Its IUPAC name is 2-methyl-1-(2,4,5-trifluorophenyl)propan-1-one.
| Compound Name | 2-methyl-1-(2,4,5-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 22953700 |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-methyl-1-(2,4,5-trifluorophenyl)propan-1-one |
| SMILES | CC(C)C(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H9F3O/c1-5(2)10(14)6-3-8(12)9(13)4-7(6)11/h3-5H,1-2H3 |
| InChIKey | VROJZTWOLQIHHB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|