C10H8F2O — CID 142110375
1-(4-ethenyl-2,5-difluorophenyl)ethanone (PubChem CID 142110375) has the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. Its IUPAC name is 1-(4-ethenyl-2,5-difluorophenyl)ethanone.
| Compound Name | 1-(4-ethenyl-2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 142110375 |
| Molecular Formula | C10H8F2O |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 1-(4-ethenyl-2,5-difluorophenyl)ethanone |
| SMILES | C=Cc1cc(F)c(C(C)=O)cc1F |
| InChI | InChI=1S/C10H8F2O/c1-3-7-4-10(12)8(6(2)13)5-9(7)11/h3-5H,1H2,2H3 |
| InChIKey | BSSILCHOTXXWEH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |