C7H4Cl2NO4- — CID 163181517
2,5-dichloro-3-(dihydroxyamino)benzoate (PubChem CID 163181517) has the molecular formula C7H4Cl2NO4- and a molecular weight of 237.02 g/mol. Its IUPAC name is 2,5-dichloro-3-(dihydroxyamino)benzoate.
| Compound Name | 2,5-dichloro-3-(dihydroxyamino)benzoate |
|---|---|
| PubChem CID | 163181517 |
| Molecular Formula | C7H4Cl2NO4- |
| Molecular Weight | 237.02 g/mol |
| Exact Mass | 235.95 |
| IUPAC Name | 2,5-dichloro-3-(dihydroxyamino)benzoate |
| SMILES | O=C([O-])c1cc(Cl)cc(N(O)O)c1Cl |
| InChI | InChI=1S/C7H5Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2,13-14H,(H,11,12)/p-1 |
| InChIKey | DQDRTOAYEWHCFR-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.02 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|