C13H7Cl3FNO — CID 105350243
(3-amino-5-fluorophenyl)-(2,4,6-trichlorophenyl)methanone (PubChem CID 105350243) has the molecular formula C13H7Cl3FNO and a molecular weight of 318.56 g/mol. Its IUPAC name is (3-amino-5-fluorophenyl)-(2,4,6-trichlorophenyl)methanone.
| Compound Name | (3-amino-5-fluorophenyl)-(2,4,6-trichlorophenyl)methanone |
|---|---|
| PubChem CID | 105350243 |
| Molecular Formula | C13H7Cl3FNO |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 316.96 |
| IUPAC Name | (3-amino-5-fluorophenyl)-(2,4,6-trichlorophenyl)methanone |
| SMILES | Nc1cc(F)cc(C(=O)c2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H7Cl3FNO/c14-7-3-10(15)12(11(16)4-7)13(19)6-1-8(17)5-9(18)2-6/h1-5H,18H2 |
| InChIKey | QUMDJFSUKLRCPL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|