C13H9F3N2O — CID 103304686
(3,5-diaminophenyl)-(2,4,5-trifluorophenyl)methanone (PubChem CID 103304686) has the molecular formula C13H9F3N2O and a molecular weight of 266.22 g/mol. Its IUPAC name is (3,5-diaminophenyl)-(2,4,5-trifluorophenyl)methanone.
| Compound Name | (3,5-diaminophenyl)-(2,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 103304686 |
| Molecular Formula | C13H9F3N2O |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (3,5-diaminophenyl)-(2,4,5-trifluorophenyl)methanone |
| SMILES | Nc1cc(N)cc(C(=O)c2cc(F)c(F)cc2F)c1 |
| InChI | InChI=1S/C13H9F3N2O/c14-10-5-12(16)11(15)4-9(10)13(19)6-1-7(17)3-8(18)2-6/h1-5H,17-18H2 |
| InChIKey | DNBJAVOWXNMUPG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|