C11H8Cl2O — CID 114972777
1-(2,6-dichlorophenyl)pent-4-yn-1-one (PubChem CID 114972777) has the molecular formula C11H8Cl2O and a molecular weight of 227.09 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)pent-4-yn-1-one.
| Compound Name | 1-(2,6-dichlorophenyl)pent-4-yn-1-one |
|---|---|
| PubChem CID | 114972777 |
| Molecular Formula | C11H8Cl2O |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 1-(2,6-dichlorophenyl)pent-4-yn-1-one |
| SMILES | C#CCCC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H8Cl2O/c1-2-3-7-10(14)11-8(12)5-4-6-9(11)13/h1,4-6H,3,7H2 |
| InChIKey | HIOWBNFKZFTRSI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|