C19H21IO6 — CID 10972757
2-(2-iodo-4,5-dimethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)ethanone (PubChem CID 10972757) has the molecular formula C19H21IO6 and a molecular weight of 472.28 g/mol. Its IUPAC name is 2-(2-iodo-4,5-dimethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)ethanone.
| Compound Name | 2-(2-iodo-4,5-dimethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 10972757 |
| Molecular Formula | C19H21IO6 |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 2-(2-iodo-4,5-dimethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(I)c(CC(=O)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H21IO6/c1-22-15-7-11(13(20)10-16(15)23-2)6-14(21)12-8-17(24-3)19(26-5)18(9-12)25-4/h7-10H,6H2,1-5H3 |
| InChIKey | MERRBPSIAFQHHE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|