C15H22ClNO4S — CID 2200633
4-chloro-N-cycloheptyl-2,5-dimethoxybenzenesulfonamide (PubChem CID 2200633) has the molecular formula C15H22ClNO4S and a molecular weight of 347.86 g/mol. Its IUPAC name is 4-chloro-N-cycloheptyl-2,5-dimethoxybenzenesulfonamide.
| Compound Name | 4-chloro-N-cycloheptyl-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 2200633 |
| Molecular Formula | C15H22ClNO4S |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-chloro-N-cycloheptyl-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NC2CCCCCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C15H22ClNO4S/c1-20-13-10-15(14(21-2)9-12(13)16)22(18,19)17-11-7-5-3-4-6-8-11/h9-11,17H,3-8H2,1-2H3 |
| InChIKey | XHNFGJUOMQCPTG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |